C14H17FOS — CID 54974432
3-[5-(butylsulfanylmethyl)-2-fluorophenyl]prop-2-yn-1-ol (PubChem CID 54974432) has the molecular formula C14H17FOS and a molecular weight of 252.35 g/mol. Its IUPAC name is 3-[5-(butylsulfanylmethyl)-2-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[5-(butylsulfanylmethyl)-2-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 54974432 |
| Molecular Formula | C14H17FOS |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-[5-(butylsulfanylmethyl)-2-fluorophenyl]prop-2-yn-1-ol |
| SMILES | CCCCSCc1ccc(F)c(C#CCO)c1 |
| InChI | InChI=1S/C14H17FOS/c1-2-3-9-17-11-12-6-7-14(15)13(10-12)5-4-8-16/h6-7,10,16H,2-3,8-9,11H2,1H3 |
| InChIKey | AFDFCKNKEWUDRS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|