C17H14ClFOS — CID 103289440
3-[5-[(2-chlorophenyl)methylsulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol (PubChem CID 103289440) has the molecular formula C17H14ClFOS and a molecular weight of 320.82 g/mol. Its IUPAC name is 3-[5-[(2-chlorophenyl)methylsulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[5-[(2-chlorophenyl)methylsulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 103289440 |
| Molecular Formula | C17H14ClFOS |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 3-[5-[(2-chlorophenyl)methylsulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1cc(CSCc2ccccc2Cl)ccc1F |
| InChI | InChI=1S/C17H14ClFOS/c18-16-6-2-1-4-15(16)12-21-11-13-7-8-17(19)14(10-13)5-3-9-20/h1-2,4,6-8,10,20H,9,11-12H2 |
| InChIKey | NEPSQAVVVRYUJL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|