C15H14ClNS2 — CID 103289404
3-[2-[(2-chlorophenyl)methylsulfanylmethyl]thiophen-3-yl]prop-2-yn-1-amine (PubChem CID 103289404) has the molecular formula C15H14ClNS2 and a molecular weight of 307.87 g/mol. Its IUPAC name is 3-[2-[(2-chlorophenyl)methylsulfanylmethyl]thiophen-3-yl]prop-2-yn-1-amine.
| Compound Name | 3-[2-[(2-chlorophenyl)methylsulfanylmethyl]thiophen-3-yl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 103289404 |
| Molecular Formula | C15H14ClNS2 |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 3-[2-[(2-chlorophenyl)methylsulfanylmethyl]thiophen-3-yl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1ccsc1CSCc1ccccc1Cl |
| InChI | InChI=1S/C15H14ClNS2/c16-14-6-2-1-4-13(14)10-18-11-15-12(5-3-8-17)7-9-19-15/h1-2,4,6-7,9H,8,10-11,17H2 |
| InChIKey | MNNKPVYAZFYUQB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|