C16H15NO2S2 — CID 115478830
3-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)thiophen-3-yl]prop-2-yn-1-amine (PubChem CID 115478830) has the molecular formula C16H15NO2S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 3-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)thiophen-3-yl]prop-2-yn-1-amine.
| Compound Name | 3-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)thiophen-3-yl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 115478830 |
| Molecular Formula | C16H15NO2S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 3-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)thiophen-3-yl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1ccsc1CSc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H15NO2S2/c17-6-1-2-12-5-9-20-16(12)11-21-13-3-4-14-15(10-13)19-8-7-18-14/h3-5,9-10H,6-8,11,17H2 |
| InChIKey | DOKHMUIKHLCQRM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|