About 2-fluoro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid
2-fluoro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid (PubChem CID 104604154) has the molecular formula C10H8FN3O2S
and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-fluoro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid.
Analyze 2-fluoro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid?
The IUPAC name of 2-fluoro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid (CID 104604154) is 2-fluoro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid.
What is the SMILES notation for 2-fluoro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid?
The canonical SMILES for 2-fluoro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid is Cn1ncnc1Sc1cccc(F)c1C(=O)O.
What is the InChIKey of 2-fluoro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid?
The InChIKey is YQHGGWVWBZOWLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FN3O2S/c1-14-10(12-5-13-14)17-7-4-2-3-6(11)8(7)9(15)16/h2-5H,1H3,(H,15,16).
What are the key properties of 2-fluoro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid?
2-fluoro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid has a molecular weight of 253.26 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid is sourced from PubChem (CID 104604154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).