C8H13N5 — CID 104605476
5-(4-aminocyclopent-2-en-1-yl)-2-methyl-1,2,4-triazol-3-amine (PubChem CID 104605476) has the molecular formula C8H13N5 and a molecular weight of 179.23 g/mol. Its IUPAC name is 5-(4-aminocyclopent-2-en-1-yl)-2-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(4-aminocyclopent-2-en-1-yl)-2-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 104605476 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 5-(4-aminocyclopent-2-en-1-yl)-2-methyl-1,2,4-triazol-3-amine |
| SMILES | Cn1nc(C2C=CC(N)C2)nc1N |
| InChI | InChI=1S/C8H13N5/c1-13-8(10)11-7(12-13)5-2-3-6(9)4-5/h2-3,5-6H,4,9H2,1H3,(H2,10,11,12) |
| InChIKey | KTWDXAYJEHANNL-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|