C9H10FN3O2 — CID 104605905
2-cyclopropyl-2-[(5-fluoropyrimidin-2-yl)amino]acetic acid (PubChem CID 104605905) has the molecular formula C9H10FN3O2 and a molecular weight of 211.20 g/mol. Its IUPAC name is 2-cyclopropyl-2-[(5-fluoropyrimidin-2-yl)amino]acetic acid.
| Compound Name | 2-cyclopropyl-2-[(5-fluoropyrimidin-2-yl)amino]acetic acid |
|---|---|
| PubChem CID | 104605905 |
| Molecular Formula | C9H10FN3O2 |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-cyclopropyl-2-[(5-fluoropyrimidin-2-yl)amino]acetic acid |
| SMILES | O=C(O)C(Nc1ncc(F)cn1)C1CC1 |
| InChI | InChI=1S/C9H10FN3O2/c10-6-3-11-9(12-4-6)13-7(8(14)15)5-1-2-5/h3-5,7H,1-2H2,(H,14,15)(H,11,12,13) |
| InChIKey | HSACZDQAUMKDPM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |