C10H12FN3O3 — CID 104605960
4-[(5-fluoropyrimidin-2-yl)amino]-3-methyloxolane-3-carboxylic acid (PubChem CID 104605960) has the molecular formula C10H12FN3O3 and a molecular weight of 241.22 g/mol. Its IUPAC name is 4-[(5-fluoropyrimidin-2-yl)amino]-3-methyloxolane-3-carboxylic acid.
| Compound Name | 4-[(5-fluoropyrimidin-2-yl)amino]-3-methyloxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 104605960 |
| Molecular Formula | C10H12FN3O3 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 4-[(5-fluoropyrimidin-2-yl)amino]-3-methyloxolane-3-carboxylic acid |
| SMILES | CC1(C(=O)O)COCC1Nc1ncc(F)cn1 |
| InChI | InChI=1S/C10H12FN3O3/c1-10(8(15)16)5-17-4-7(10)14-9-12-2-6(11)3-13-9/h2-3,7H,4-5H2,1H3,(H,15,16)(H,12,13,14) |
| InChIKey | YCGVXHZXIMYVFY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |