C14H21N3O4 — CID 115973140
3-methyl-4-[(4-methyl-6-propoxypyrimidin-2-yl)amino]oxolane-3-carboxylic acid (PubChem CID 115973140) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-methyl-4-[(4-methyl-6-propoxypyrimidin-2-yl)amino]oxolane-3-carboxylic acid.
| Compound Name | 3-methyl-4-[(4-methyl-6-propoxypyrimidin-2-yl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 115973140 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 3-methyl-4-[(4-methyl-6-propoxypyrimidin-2-yl)amino]oxolane-3-carboxylic acid |
| SMILES | CCCOc1cc(C)nc(NC2COCC2(C)C(=O)O)n1 |
| InChI | InChI=1S/C14H21N3O4/c1-4-5-21-11-6-9(2)15-13(17-11)16-10-7-20-8-14(10,3)12(18)19/h6,10H,4-5,7-8H2,1-3H3,(H,18,19)(H,15,16,17) |
| InChIKey | ACMMKPATVXAQET-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |