C14H22ClN3O — CID 114632140
N-(3-chloro-2,2-dimethylcyclobutyl)-4-methyl-6-propoxypyrimidin-2-amine (PubChem CID 114632140) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylcyclobutyl)-4-methyl-6-propoxypyrimidin-2-amine.
| Compound Name | N-(3-chloro-2,2-dimethylcyclobutyl)-4-methyl-6-propoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 114632140 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-(3-chloro-2,2-dimethylcyclobutyl)-4-methyl-6-propoxypyrimidin-2-amine |
| SMILES | CCCOc1cc(C)nc(NC2CC(Cl)C2(C)C)n1 |
| InChI | InChI=1S/C14H22ClN3O/c1-5-6-19-12-7-9(2)16-13(18-12)17-11-8-10(15)14(11,3)4/h7,10-11H,5-6,8H2,1-4H3,(H,16,17,18) |
| InChIKey | LTEVMXHLVCNHAE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|