C13H20ClN3O — CID 114632018
N-(3-chloro-2,2-dimethylcyclobutyl)-6-propoxypyrimidin-4-amine (PubChem CID 114632018) has the molecular formula C13H20ClN3O and a molecular weight of 269.78 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylcyclobutyl)-6-propoxypyrimidin-4-amine.
| Compound Name | N-(3-chloro-2,2-dimethylcyclobutyl)-6-propoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 114632018 |
| Molecular Formula | C13H20ClN3O |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-(3-chloro-2,2-dimethylcyclobutyl)-6-propoxypyrimidin-4-amine |
| SMILES | CCCOc1cc(NC2CC(Cl)C2(C)C)ncn1 |
| InChI | InChI=1S/C13H20ClN3O/c1-4-5-18-12-7-11(15-8-16-12)17-10-6-9(14)13(10,2)3/h7-10H,4-6H2,1-3H3,(H,15,16,17) |
| InChIKey | RVTHUUMNQRWXCY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|