C15H25N3O — CID 66330206
N-(3,5-dimethylcyclohexyl)-6-propoxypyrimidin-4-amine (PubChem CID 66330206) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexyl)-6-propoxypyrimidin-4-amine.
| Compound Name | N-(3,5-dimethylcyclohexyl)-6-propoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 66330206 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | N-(3,5-dimethylcyclohexyl)-6-propoxypyrimidin-4-amine |
| SMILES | CCCOc1cc(NC2CC(C)CC(C)C2)ncn1 |
| InChI | InChI=1S/C15H25N3O/c1-4-5-19-15-9-14(16-10-17-15)18-13-7-11(2)6-12(3)8-13/h9-13H,4-8H2,1-3H3,(H,16,17,18) |
| InChIKey | MYSRKRVRDVBXBH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |