C11H15NO5 — CID 104607291
5-[1-methoxypropan-2-yl(methyl)carbamoyl]furan-3-carboxylic acid (PubChem CID 104607291) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is 5-[1-methoxypropan-2-yl(methyl)carbamoyl]furan-3-carboxylic acid.
| Compound Name | 5-[1-methoxypropan-2-yl(methyl)carbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104607291 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 5-[1-methoxypropan-2-yl(methyl)carbamoyl]furan-3-carboxylic acid |
| SMILES | COCC(C)N(C)C(=O)c1cc(C(=O)O)co1 |
| InChI | InChI=1S/C11H15NO5/c1-7(5-16-3)12(2)10(13)9-4-8(6-17-9)11(14)15/h4,6-7H,5H2,1-3H3,(H,14,15) |
| InChIKey | BCMAABFBGKJJAM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |