C13H10N2O6 — CID 104607472
5-[(2-nitrophenyl)methylcarbamoyl]furan-3-carboxylic acid (PubChem CID 104607472) has the molecular formula C13H10N2O6 and a molecular weight of 290.23 g/mol. Its IUPAC name is 5-[(2-nitrophenyl)methylcarbamoyl]furan-3-carboxylic acid.
| Compound Name | 5-[(2-nitrophenyl)methylcarbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104607472 |
| Molecular Formula | C13H10N2O6 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 5-[(2-nitrophenyl)methylcarbamoyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1coc(C(=O)NCc2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10N2O6/c16-12(11-5-9(7-21-11)13(17)18)14-6-8-3-1-2-4-10(8)15(19)20/h1-5,7H,6H2,(H,14,16)(H,17,18) |
| InChIKey | WFOJUPVOWLUFNX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|