C11H10N4O3 — CID 60979424
N-[(2-nitrophenyl)methyl]-1H-pyrazole-4-carboxamide (PubChem CID 60979424) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is N-[(2-nitrophenyl)methyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(2-nitrophenyl)methyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60979424 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | N-[(2-nitrophenyl)methyl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1[N+](=O)[O-])c1cn[nH]c1 |
| InChI | InChI=1S/C11H10N4O3/c16-11(9-6-13-14-7-9)12-5-8-3-1-2-4-10(8)15(17)18/h1-4,6-7H,5H2,(H,12,16)(H,13,14) |
| InChIKey | OAYBRRGUSZRCGM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|