C13H11F2NO4 — CID 104608047
5-[[2-(difluoromethoxy)anilino]methyl]furan-3-carboxylic acid (PubChem CID 104608047) has the molecular formula C13H11F2NO4 and a molecular weight of 283.23 g/mol. Its IUPAC name is 5-[[2-(difluoromethoxy)anilino]methyl]furan-3-carboxylic acid.
| Compound Name | 5-[[2-(difluoromethoxy)anilino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104608047 |
| Molecular Formula | C13H11F2NO4 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 5-[[2-(difluoromethoxy)anilino]methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1coc(CNc2ccccc2OC(F)F)c1 |
| InChI | InChI=1S/C13H11F2NO4/c14-13(15)20-11-4-2-1-3-10(11)16-6-9-5-8(7-19-9)12(17)18/h1-5,7,13,16H,6H2,(H,17,18) |
| InChIKey | ARXIUKJHANOXQG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |