C14H14FNO4 — CID 104608490
5-[(2-ethoxy-4-fluoroanilino)methyl]furan-3-carboxylic acid (PubChem CID 104608490) has the molecular formula C14H14FNO4 and a molecular weight of 279.27 g/mol. Its IUPAC name is 5-[(2-ethoxy-4-fluoroanilino)methyl]furan-3-carboxylic acid.
| Compound Name | 5-[(2-ethoxy-4-fluoroanilino)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104608490 |
| Molecular Formula | C14H14FNO4 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 5-[(2-ethoxy-4-fluoroanilino)methyl]furan-3-carboxylic acid |
| SMILES | CCOc1cc(F)ccc1NCc1cc(C(=O)O)co1 |
| InChI | InChI=1S/C14H14FNO4/c1-2-19-13-6-10(15)3-4-12(13)16-7-11-5-9(8-20-11)14(17)18/h3-6,8,16H,2,7H2,1H3,(H,17,18) |
| InChIKey | JCKNMBDVAGBIKZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |