C14H18N2O3S — CID 104608110
5-[[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]methyl]furan-3-carboxylic acid (PubChem CID 104608110) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 5-[[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]methyl]furan-3-carboxylic acid.
| Compound Name | 5-[[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104608110 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-[[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]methyl]furan-3-carboxylic acid |
| SMILES | CN(C)C(CNCc1cc(C(=O)O)co1)c1cccs1 |
| InChI | InChI=1S/C14H18N2O3S/c1-16(2)12(13-4-3-5-20-13)8-15-7-11-6-10(9-19-11)14(17)18/h3-6,9,12,15H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | SCQKGKSNTVGQNI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |