C14H15NO5S — CID 104608478
3-[(4-methoxycarbonylfuran-2-yl)methylamino]-3-thiophen-2-ylpropanoic acid (PubChem CID 104608478) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is 3-[(4-methoxycarbonylfuran-2-yl)methylamino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[(4-methoxycarbonylfuran-2-yl)methylamino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 104608478 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-[(4-methoxycarbonylfuran-2-yl)methylamino]-3-thiophen-2-ylpropanoic acid |
| SMILES | COC(=O)c1coc(CNC(CC(=O)O)c2cccs2)c1 |
| InChI | InChI=1S/C14H15NO5S/c1-19-14(18)9-5-10(20-8-9)7-15-11(6-13(16)17)12-3-2-4-21-12/h2-5,8,11,15H,6-7H2,1H3,(H,16,17) |
| InChIKey | ZNCQFQRFOVOLSW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |