C17H14ClF2N5O3 — CID 1046122
N-[4-[chloro(difluoro)methoxy]phenyl]-2-[5-(4-methoxyphenyl)tetrazol-2-yl]acetamide (PubChem CID 1046122) has the molecular formula C17H14ClF2N5O3 and a molecular weight of 409.78 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-2-[5-(4-methoxyphenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-2-[5-(4-methoxyphenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 1046122 |
| Molecular Formula | C17H14ClF2N5O3 |
| Molecular Weight | 409.78 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-2-[5-(4-methoxyphenyl)tetrazol-2-yl]acetamide |
| SMILES | COc1ccc(-c2nnn(CC(=O)Nc3ccc(OC(F)(F)Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C17H14ClF2N5O3/c1-27-13-6-2-11(3-7-13)16-22-24-25(23-16)10-15(26)21-12-4-8-14(9-5-12)28-17(18,19)20/h2-9H,10H2,1H3,(H,21,26) |
| InChIKey | WWSBPQIQEGEHCC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.78 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|