C15H15N3O3 — CID 104614062
1-(quinoxaline-5-carbonyl)piperidine-3-carboxylic acid (PubChem CID 104614062) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 1-(quinoxaline-5-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(quinoxaline-5-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 104614062 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-(quinoxaline-5-carbonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)c2cccc3nccnc23)C1 |
| InChI | InChI=1S/C15H15N3O3/c19-14(18-8-2-3-10(9-18)15(20)21)11-4-1-5-12-13(11)17-7-6-16-12/h1,4-7,10H,2-3,8-9H2,(H,20,21) |
| InChIKey | ILWFUWBTLPTGRV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |