C16H18N4O — CID 104615547
3,9-diazabicyclo[4.2.1]nonan-3-yl(quinoxalin-5-yl)methanone (PubChem CID 104615547) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 3,9-diazabicyclo[4.2.1]nonan-3-yl(quinoxalin-5-yl)methanone.
| Compound Name | 3,9-diazabicyclo[4.2.1]nonan-3-yl(quinoxalin-5-yl)methanone |
|---|---|
| PubChem CID | 104615547 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 3,9-diazabicyclo[4.2.1]nonan-3-yl(quinoxalin-5-yl)methanone |
| SMILES | O=C(c1cccc2nccnc12)N1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C16H18N4O/c21-16(20-9-6-11-4-5-12(10-20)19-11)13-2-1-3-14-15(13)18-8-7-17-14/h1-3,7-8,11-12,19H,4-6,9-10H2 |
| InChIKey | QVHOJAFSRSGSOL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |