C15H15N3O3 — CID 104614148
3-(quinoxaline-5-carbonylamino)cyclopentane-1-carboxylic acid (PubChem CID 104614148) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 3-(quinoxaline-5-carbonylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(quinoxaline-5-carbonylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 104614148 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 3-(quinoxaline-5-carbonylamino)cyclopentane-1-carboxylic acid |
| SMILES | O=C(NC1CCC(C(=O)O)C1)c1cccc2nccnc12 |
| InChI | InChI=1S/C15H15N3O3/c19-14(18-10-5-4-9(8-10)15(20)21)11-2-1-3-12-13(11)17-7-6-16-12/h1-3,6-7,9-10H,4-5,8H2,(H,18,19)(H,20,21) |
| InChIKey | OTOJQPMCLNGAJK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |