C14H17N3O — CID 104614221
1-(oxolan-2-yl)-N-(quinoxalin-5-ylmethyl)methanamine (PubChem CID 104614221) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 1-(oxolan-2-yl)-N-(quinoxalin-5-ylmethyl)methanamine.
| Compound Name | 1-(oxolan-2-yl)-N-(quinoxalin-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 104614221 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-(oxolan-2-yl)-N-(quinoxalin-5-ylmethyl)methanamine |
| SMILES | c1cc(CNCC2CCCO2)c2nccnc2c1 |
| InChI | InChI=1S/C14H17N3O/c1-3-11(9-15-10-12-4-2-8-18-12)14-13(5-1)16-6-7-17-14/h1,3,5-7,12,15H,2,4,8-10H2 |
| InChIKey | JSHVFMCBHIQSGR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |