C17H23N3O — CID 104615113
2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl(1,2,3,4-tetrahydroquinoxalin-6-yl)methanone (PubChem CID 104615113) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl(1,2,3,4-tetrahydroquinoxalin-6-yl)methanone.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl(1,2,3,4-tetrahydroquinoxalin-6-yl)methanone |
|---|---|
| PubChem CID | 104615113 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl(1,2,3,4-tetrahydroquinoxalin-6-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)NCCN2)N1CCCC2CCCC21 |
| InChI | InChI=1S/C17H23N3O/c21-17(20-10-2-4-12-3-1-5-16(12)20)13-6-7-14-15(11-13)19-9-8-18-14/h6-7,11-12,16,18-19H,1-5,8-10H2 |
| InChIKey | YAKATGBPPFWVLA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |