C13H14N6O — CID 104616617
5-amino-N-(4-ethyl-1H-pyrazol-5-yl)-1H-indazole-3-carboxamide (PubChem CID 104616617) has the molecular formula C13H14N6O and a molecular weight of 270.30 g/mol. Its IUPAC name is 5-amino-N-(4-ethyl-1H-pyrazol-5-yl)-1H-indazole-3-carboxamide.
| Compound Name | 5-amino-N-(4-ethyl-1H-pyrazol-5-yl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 104616617 |
| Molecular Formula | C13H14N6O |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 5-amino-N-(4-ethyl-1H-pyrazol-5-yl)-1H-indazole-3-carboxamide |
| SMILES | CCc1cn[nH]c1NC(=O)c1n[nH]c2ccc(N)cc12 |
| InChI | InChI=1S/C13H14N6O/c1-2-7-6-15-19-12(7)16-13(20)11-9-5-8(14)3-4-10(9)17-18-11/h3-6H,2,14H2,1H3,(H,17,18)(H2,15,16,19,20) |
| InChIKey | OLFNLSVSMWZQQL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|