About (2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)methanamine
(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)methanamine (PubChem CID 104621808) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is (2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)methanamine.
Analyze (2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)methanamine?
The IUPAC name of (2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)methanamine (CID 104621808) is (2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)methanamine.
What is the SMILES notation for (2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)methanamine?
The canonical SMILES for (2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)methanamine is Cc1nn2cc(CN)cnc2c1C.
What is the InChIKey of (2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)methanamine?
The InChIKey is VKCACIHXWADRNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-6-7(2)12-13-5-8(3-10)4-11-9(6)13/h4-5H,3,10H2,1-2H3.
What are the key properties of (2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)methanamine?
(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)methanamine has a molecular weight of 176.22 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)methanamine is sourced from PubChem (CID 104621808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).