C21H25N3O2S — CID 86881288
3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl 3-(4-methylphenyl)sulfanylpropanoate (PubChem CID 86881288) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl 3-(4-methylphenyl)sulfanylpropanoate.
| Compound Name | 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl 3-(4-methylphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 86881288 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl 3-(4-methylphenyl)sulfanylpropanoate |
| SMILES | Cc1ccc(SCCC(=O)OCCCc2cnc3c(C)c(C)nn3c2)cc1 |
| InChI | InChI=1S/C21H25N3O2S/c1-15-6-8-19(9-7-15)27-12-10-20(25)26-11-4-5-18-13-22-21-16(2)17(3)23-24(21)14-18/h6-9,13-14H,4-5,10-12H2,1-3H3 |
| InChIKey | OQHJAYSEMVLWOL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|