C14H13F5N2 — CID 104622397
4,6-difluoro-2-[2-(trifluoromethyl)cyclohexyl]-1H-benzimidazole (PubChem CID 104622397) has the molecular formula C14H13F5N2 and a molecular weight of 304.26 g/mol. Its IUPAC name is 4,6-difluoro-2-[2-(trifluoromethyl)cyclohexyl]-1H-benzimidazole.
| Compound Name | 4,6-difluoro-2-[2-(trifluoromethyl)cyclohexyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 104622397 |
| Molecular Formula | C14H13F5N2 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4,6-difluoro-2-[2-(trifluoromethyl)cyclohexyl]-1H-benzimidazole |
| SMILES | Fc1cc(F)c2nc(C3CCCCC3C(F)(F)F)[nH]c2c1 |
| InChI | InChI=1S/C14H13F5N2/c15-7-5-10(16)12-11(6-7)20-13(21-12)8-3-1-2-4-9(8)14(17,18)19/h5-6,8-9H,1-4H2,(H,20,21) |
| InChIKey | HSDDEPPGGPWDKK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |