C14H15ClF3N3 — CID 104622206
6-chloro-2-[2-(trifluoromethyl)cyclohexyl]-1H-benzimidazol-4-amine (PubChem CID 104622206) has the molecular formula C14H15ClF3N3 and a molecular weight of 317.74 g/mol. Its IUPAC name is 6-chloro-2-[2-(trifluoromethyl)cyclohexyl]-1H-benzimidazol-4-amine.
| Compound Name | 6-chloro-2-[2-(trifluoromethyl)cyclohexyl]-1H-benzimidazol-4-amine |
|---|---|
| PubChem CID | 104622206 |
| Molecular Formula | C14H15ClF3N3 |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 6-chloro-2-[2-(trifluoromethyl)cyclohexyl]-1H-benzimidazol-4-amine |
| SMILES | Nc1cc(Cl)cc2[nH]c(C3CCCCC3C(F)(F)F)nc12 |
| InChI | InChI=1S/C14H15ClF3N3/c15-7-5-10(19)12-11(6-7)20-13(21-12)8-3-1-2-4-9(8)14(16,17)18/h5-6,8-9H,1-4,19H2,(H,20,21) |
| InChIKey | ZVOVHVMZKFMVRA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|