C10H12ClF3N4 — CID 113434047
4-chloro-6-[2-(trifluoromethyl)cyclohexyl]-1,3,5-triazin-2-amine (PubChem CID 113434047) has the molecular formula C10H12ClF3N4 and a molecular weight of 280.68 g/mol. Its IUPAC name is 4-chloro-6-[2-(trifluoromethyl)cyclohexyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-[2-(trifluoromethyl)cyclohexyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 113434047 |
| Molecular Formula | C10H12ClF3N4 |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-chloro-6-[2-(trifluoromethyl)cyclohexyl]-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Cl)nc(C2CCCCC2C(F)(F)F)n1 |
| InChI | InChI=1S/C10H12ClF3N4/c11-8-16-7(17-9(15)18-8)5-3-1-2-4-6(5)10(12,13)14/h5-6H,1-4H2,(H2,15,16,17,18) |
| InChIKey | HNKRCSIPZAPUOY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |