C10H15ClN4 — CID 83240446
4-chloro-6-(cyclohexylmethyl)-1,3,5-triazin-2-amine (PubChem CID 83240446) has the molecular formula C10H15ClN4 and a molecular weight of 226.71 g/mol. Its IUPAC name is 4-chloro-6-(cyclohexylmethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(cyclohexylmethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 83240446 |
| Molecular Formula | C10H15ClN4 |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-chloro-6-(cyclohexylmethyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Cl)nc(CC2CCCCC2)n1 |
| InChI | InChI=1S/C10H15ClN4/c11-9-13-8(14-10(12)15-9)6-7-4-2-1-3-5-7/h7H,1-6H2,(H2,12,13,14,15) |
| InChIKey | VXVKUPRXJYLOED-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |