C13H14ClN5 — CID 138974253
4-chloro-6-(1-phenylpyrrolidin-2-yl)-1,3,5-triazin-2-amine (PubChem CID 138974253) has the molecular formula C13H14ClN5 and a molecular weight of 275.74 g/mol. Its IUPAC name is 4-chloro-6-(1-phenylpyrrolidin-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(1-phenylpyrrolidin-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 138974253 |
| Molecular Formula | C13H14ClN5 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-chloro-6-(1-phenylpyrrolidin-2-yl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Cl)nc(C2CCCN2c2ccccc2)n1 |
| InChI | InChI=1S/C13H14ClN5/c14-12-16-11(17-13(15)18-12)10-7-4-8-19(10)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2,(H2,15,16,17,18) |
| InChIKey | VWVBEOUCIOWNSR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |