About 3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide
3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide (PubChem CID 104625733) has the molecular formula C12H19N3O3
and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide.
Molecular Properties
| Compound Name | 3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide |
| PubChem CID | 104625733 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide |
| SMILES | CCc1nnc(C)cc1C(=O)N(CCO)CCO |
| InChI | InChI=1S/C12H19N3O3/c1-3-11-10(8-9(2)13-14-11)12(18)15(4-6-16)5-7-17/h8,16-17H,3-7H2,1-2H3 |
| InChIKey | MPTBLNNUSUKRTD-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide?
The IUPAC name of 3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide (CID 104625733) is 3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide.
What is the SMILES notation for 3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide?
The canonical SMILES for 3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide is CCc1nnc(C)cc1C(=O)N(CCO)CCO.
What is the InChIKey of 3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide?
The InChIKey is MPTBLNNUSUKRTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3/c1-3-11-10(8-9(2)13-14-11)12(18)15(4-6-16)5-7-17/h8,16-17H,3-7H2,1-2H3.
What are the key properties of 3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide?
3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide has a molecular weight of 253.30 g/mol, XLogP of -0.23, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N,N-bis(2-hydroxyethyl)-6-methylpyridazine-4-carboxamide is sourced from PubChem (CID 104625733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).