C11H16BrN3O — CID 104672507
N-(2-bromoethyl)-3-ethyl-N,6-dimethylpyridazine-4-carboxamide (PubChem CID 104672507) has the molecular formula C11H16BrN3O and a molecular weight of 286.17 g/mol. Its IUPAC name is N-(2-bromoethyl)-3-ethyl-N,6-dimethylpyridazine-4-carboxamide.
| Compound Name | N-(2-bromoethyl)-3-ethyl-N,6-dimethylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104672507 |
| Molecular Formula | C11H16BrN3O |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | N-(2-bromoethyl)-3-ethyl-N,6-dimethylpyridazine-4-carboxamide |
| SMILES | CCc1nnc(C)cc1C(=O)N(C)CCBr |
| InChI | InChI=1S/C11H16BrN3O/c1-4-10-9(7-8(2)13-14-10)11(16)15(3)6-5-12/h7H,4-6H2,1-3H3 |
| InChIKey | JZHVPVBXXVKSHC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|