C16H18BrN3O — CID 107233817
N-[[4-(bromomethyl)phenyl]methyl]-3-ethyl-6-methylpyridazine-4-carboxamide (PubChem CID 107233817) has the molecular formula C16H18BrN3O and a molecular weight of 348.24 g/mol. Its IUPAC name is N-[[4-(bromomethyl)phenyl]methyl]-3-ethyl-6-methylpyridazine-4-carboxamide.
| Compound Name | N-[[4-(bromomethyl)phenyl]methyl]-3-ethyl-6-methylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 107233817 |
| Molecular Formula | C16H18BrN3O |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-[[4-(bromomethyl)phenyl]methyl]-3-ethyl-6-methylpyridazine-4-carboxamide |
| SMILES | CCc1nnc(C)cc1C(=O)NCc1ccc(CBr)cc1 |
| InChI | InChI=1S/C16H18BrN3O/c1-3-15-14(8-11(2)19-20-15)16(21)18-10-13-6-4-12(9-17)5-7-13/h4-8H,3,9-10H2,1-2H3,(H,18,21) |
| InChIKey | KLAKWTOPVDRJED-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|