C14H22BrN3O — CID 107847967
N-(6-bromohexyl)-3-ethyl-6-methylpyridazine-4-carboxamide (PubChem CID 107847967) has the molecular formula C14H22BrN3O and a molecular weight of 328.25 g/mol. Its IUPAC name is N-(6-bromohexyl)-3-ethyl-6-methylpyridazine-4-carboxamide.
| Compound Name | N-(6-bromohexyl)-3-ethyl-6-methylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 107847967 |
| Molecular Formula | C14H22BrN3O |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-(6-bromohexyl)-3-ethyl-6-methylpyridazine-4-carboxamide |
| SMILES | CCc1nnc(C)cc1C(=O)NCCCCCCBr |
| InChI | InChI=1S/C14H22BrN3O/c1-3-13-12(10-11(2)17-18-13)14(19)16-9-7-5-4-6-8-15/h10H,3-9H2,1-2H3,(H,16,19) |
| InChIKey | ABGWUFSYNFXULC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|