C10H15N3O3 — CID 104627104
N-(2-hydroxy-3-methoxypropyl)-N-methylpyrimidine-5-carboxamide (PubChem CID 104627104) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is N-(2-hydroxy-3-methoxypropyl)-N-methylpyrimidine-5-carboxamide.
| Compound Name | N-(2-hydroxy-3-methoxypropyl)-N-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 104627104 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | N-(2-hydroxy-3-methoxypropyl)-N-methylpyrimidine-5-carboxamide |
| SMILES | COCC(O)CN(C)C(=O)c1cncnc1 |
| InChI | InChI=1S/C10H15N3O3/c1-13(5-9(14)6-16-2)10(15)8-3-11-7-12-4-8/h3-4,7,9,14H,5-6H2,1-2H3 |
| InChIKey | AZLVVCWRMBQZKE-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |