C12H19NO3S — CID 54993258
3-ethyl-N-(2-hydroxy-3-methoxypropyl)-N-methylthiophene-2-carboxamide (PubChem CID 54993258) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 3-ethyl-N-(2-hydroxy-3-methoxypropyl)-N-methylthiophene-2-carboxamide.
| Compound Name | 3-ethyl-N-(2-hydroxy-3-methoxypropyl)-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 54993258 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-ethyl-N-(2-hydroxy-3-methoxypropyl)-N-methylthiophene-2-carboxamide |
| SMILES | CCc1ccsc1C(=O)N(C)CC(O)COC |
| InChI | InChI=1S/C12H19NO3S/c1-4-9-5-6-17-11(9)12(15)13(2)7-10(14)8-16-3/h5-6,10,14H,4,7-8H2,1-3H3 |
| InChIKey | VYTURABTBNBCLE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |