C12H17N5OS — CID 99821384
3-ethyl-N-methyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]thiophene-2-carboxamide (PubChem CID 99821384) has the molecular formula C12H17N5OS and a molecular weight of 279.37 g/mol. Its IUPAC name is 3-ethyl-N-methyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]thiophene-2-carboxamide.
| Compound Name | 3-ethyl-N-methyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 99821384 |
| Molecular Formula | C12H17N5OS |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-ethyl-N-methyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]thiophene-2-carboxamide |
| SMILES | CCc1ccsc1C(=O)N(C)C[C@@H](C)c1nn[nH]n1 |
| InChI | InChI=1S/C12H17N5OS/c1-4-9-5-6-19-10(9)12(18)17(3)7-8(2)11-13-15-16-14-11/h5-6,8H,4,7H2,1-3H3,(H,13,14,15,16)/t8-/m1/s1 |
| InChIKey | OZIBQQCUNAUGBL-MRVPVSSYSA-N |
| XLogP | 1.70 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |