C13H13N3O2 — CID 104627400
N-[4-(2-hydroxyethyl)phenyl]pyrimidine-5-carboxamide (PubChem CID 104627400) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is N-[4-(2-hydroxyethyl)phenyl]pyrimidine-5-carboxamide.
| Compound Name | N-[4-(2-hydroxyethyl)phenyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 104627400 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-[4-(2-hydroxyethyl)phenyl]pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(CCO)cc1)c1cncnc1 |
| InChI | InChI=1S/C13H13N3O2/c17-6-5-10-1-3-12(4-2-10)16-13(18)11-7-14-9-15-8-11/h1-4,7-9,17H,5-6H2,(H,16,18) |
| InChIKey | LHONFJVJVLIEIO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |