C14H14N2O3 — CID 81443250
3-hydroxy-N-[4-(2-hydroxyethyl)phenyl]pyridine-4-carboxamide (PubChem CID 81443250) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-hydroxy-N-[4-(2-hydroxyethyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 3-hydroxy-N-[4-(2-hydroxyethyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 81443250 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-hydroxy-N-[4-(2-hydroxyethyl)phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(CCO)cc1)c1ccncc1O |
| InChI | InChI=1S/C14H14N2O3/c17-8-6-10-1-3-11(4-2-10)16-14(19)12-5-7-15-9-13(12)18/h1-5,7,9,17-18H,6,8H2,(H,16,19) |
| InChIKey | RRGXOOMITUMVDZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |