C10H19Cl2NO — CID 104628208
3-(2,3-dichloroprop-2-enylamino)-4,4-dimethylpentan-1-ol (PubChem CID 104628208) has the molecular formula C10H19Cl2NO and a molecular weight of 240.17 g/mol. Its IUPAC name is 3-(2,3-dichloroprop-2-enylamino)-4,4-dimethylpentan-1-ol.
| Compound Name | 3-(2,3-dichloroprop-2-enylamino)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 104628208 |
| Molecular Formula | C10H19Cl2NO |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-(2,3-dichloroprop-2-enylamino)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(C)C(CCO)NCC(Cl)=CCl |
| InChI | InChI=1S/C10H19Cl2NO/c1-10(2,3)9(4-5-14)13-7-8(12)6-11/h6,9,13-14H,4-5,7H2,1-3H3 |
| InChIKey | FDDIFWVVDDOKJT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |