C9H17Cl2NO — CID 104891914
3-(2,3-dichloroprop-2-enylamino)-4-methylpentan-1-ol (PubChem CID 104891914) has the molecular formula C9H17Cl2NO and a molecular weight of 226.15 g/mol. Its IUPAC name is 3-(2,3-dichloroprop-2-enylamino)-4-methylpentan-1-ol.
| Compound Name | 3-(2,3-dichloroprop-2-enylamino)-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 104891914 |
| Molecular Formula | C9H17Cl2NO |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 3-(2,3-dichloroprop-2-enylamino)-4-methylpentan-1-ol |
| SMILES | CC(C)C(CCO)NCC(Cl)=CCl |
| InChI | InChI=1S/C9H17Cl2NO/c1-7(2)9(3-4-13)12-6-8(11)5-10/h5,7,9,12-13H,3-4,6H2,1-2H3 |
| InChIKey | FXKSICMUXPSCHP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |