C13H16INO3 — CID 104630748
N-(2,3-dimethyloxolan-3-yl)-3-hydroxy-4-iodobenzamide (PubChem CID 104630748) has the molecular formula C13H16INO3 and a molecular weight of 361.18 g/mol. Its IUPAC name is N-(2,3-dimethyloxolan-3-yl)-3-hydroxy-4-iodobenzamide.
| Compound Name | N-(2,3-dimethyloxolan-3-yl)-3-hydroxy-4-iodobenzamide |
|---|---|
| PubChem CID | 104630748 |
| Molecular Formula | C13H16INO3 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | N-(2,3-dimethyloxolan-3-yl)-3-hydroxy-4-iodobenzamide |
| SMILES | CC1OCCC1(C)NC(=O)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C13H16INO3/c1-8-13(2,5-6-18-8)15-12(17)9-3-4-10(14)11(16)7-9/h3-4,7-8,16H,5-6H2,1-2H3,(H,15,17) |
| InChIKey | NBCUWBRWXCBLKK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|