C13H15BrClNO2 — CID 124679722
5-bromo-2-chloro-N-[(2R,3R)-2,3-dimethyloxolan-3-yl]benzamide (PubChem CID 124679722) has the molecular formula C13H15BrClNO2 and a molecular weight of 332.63 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(2R,3R)-2,3-dimethyloxolan-3-yl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[(2R,3R)-2,3-dimethyloxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 124679722 |
| Molecular Formula | C13H15BrClNO2 |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 5-bromo-2-chloro-N-[(2R,3R)-2,3-dimethyloxolan-3-yl]benzamide |
| SMILES | C[C@H]1OCC[C@@]1(C)NC(=O)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C13H15BrClNO2/c1-8-13(2,5-6-18-8)16-12(17)10-7-9(14)3-4-11(10)15/h3-4,7-8H,5-6H2,1-2H3,(H,16,17)/t8-,13-/m1/s1 |
| InChIKey | MTSWNAWTJQLSKE-AMIZOPFISA-N |
| XLogP | 3.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |