C17H19N3S — CID 104631257
3-[[1,3-benzothiazol-2-ylmethyl(ethyl)amino]methyl]aniline (PubChem CID 104631257) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 3-[[1,3-benzothiazol-2-ylmethyl(ethyl)amino]methyl]aniline.
| Compound Name | 3-[[1,3-benzothiazol-2-ylmethyl(ethyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 104631257 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 3-[[1,3-benzothiazol-2-ylmethyl(ethyl)amino]methyl]aniline |
| SMILES | CCN(Cc1cccc(N)c1)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H19N3S/c1-2-20(11-13-6-5-7-14(18)10-13)12-17-19-15-8-3-4-9-16(15)21-17/h3-10H,2,11-12,18H2,1H3 |
| InChIKey | PWCOXTUMJQHQSL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|