C15H26N2 — CID 83157449
3-[[ethyl(4-methylpentyl)amino]methyl]aniline (PubChem CID 83157449) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 3-[[ethyl(4-methylpentyl)amino]methyl]aniline.
| Compound Name | 3-[[ethyl(4-methylpentyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 83157449 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 3-[[ethyl(4-methylpentyl)amino]methyl]aniline |
| SMILES | CCN(CCCC(C)C)Cc1cccc(N)c1 |
| InChI | InChI=1S/C15H26N2/c1-4-17(10-6-7-13(2)3)12-14-8-5-9-15(16)11-14/h5,8-9,11,13H,4,6-7,10,12,16H2,1-3H3 |
| InChIKey | LLTQIMYAJXQHAP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|