C16H28N2 — CID 62265016
3-[[2-methylpentyl(propyl)amino]methyl]aniline (PubChem CID 62265016) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 3-[[2-methylpentyl(propyl)amino]methyl]aniline.
| Compound Name | 3-[[2-methylpentyl(propyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 62265016 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 3-[[2-methylpentyl(propyl)amino]methyl]aniline |
| SMILES | CCCC(C)CN(CCC)Cc1cccc(N)c1 |
| InChI | InChI=1S/C16H28N2/c1-4-7-14(3)12-18(10-5-2)13-15-8-6-9-16(17)11-15/h6,8-9,11,14H,4-5,7,10,12-13,17H2,1-3H3 |
| InChIKey | XPDYKHJCHAKIAH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|