C9H11F4N3O — CID 104632814
1-[5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine (PubChem CID 104632814) has the molecular formula C9H11F4N3O and a molecular weight of 253.20 g/mol. Its IUPAC name is 1-[5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine.
| Compound Name | 1-[5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 104632814 |
| Molecular Formula | C9H11F4N3O |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 1-[5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine |
| SMILES | NC1(c2noc(C(F)(F)C(F)F)n2)CCCC1 |
| InChI | InChI=1S/C9H11F4N3O/c10-5(11)9(12,13)7-15-6(16-17-7)8(14)3-1-2-4-8/h5H,1-4,14H2 |
| InChIKey | HPTJQSSNWVCZDH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|